|
Structure
|
|
| Relationships |
Total Number of functionally related protein(s) :
1
Total Number of Articles : 1
|
| PubChem |
98089
|
| Molecular Formula |
C12H13N |
| SMILES |
CC(C1=CC=CC2=CC=CC=C21)N |
| InChI |
InChI=1S/C12H13N/c1-9(13)11-8-4-6-10-5-2-3-7-12(10)11/h2-9H,13H2,1H3 |
| synonyms |
- 42882-31-5
- 1-(1-Naphthyl)ethylamine
- (+/-)1-(1-Naphthyl)ethylamine
- 1-(naphthalen-1-yl)ethanamine
- 1-naphthalen-1-ylethanamine
- 1-(1-Naphthyl)ethanamine
- DL-1-(1-Naphthyl)ethylamine
- (+/-)-1-(1-Naphthyl)ethylamine
- 1-(naphthalen-1-yl)ethan-1-amine
- 3309-13-5
- R-(+)-1-(1-Naphthyl)ethylamine
- MFCD00004014
- (R)-(+)-alpha-(1-Naphthyl)ethylamine
- EN300-21182
- 1-(1-Naphthyl)ethanamine #
- 1-Naphthalen-1-yl-ethylamine
- 1-(1-napthyl)ethylamine
- MFCD00064114
- (R)-1-(naphthalen-1-yl)ethan-1-amine
- (S)-(-)-alpha-(1-Naphthyl)ethylamine
- (S)-(-)-.alpha.-(1-Naphthyl)ethylamine
- NSC 75881
- NSC180601
- NSC 180601
- 1-Naphthalenemethanamine, alpha-methyl-
- alpha-naphthylethylamine
- starbld0002964
- 1-Naphthalenemethanamine, .alpha.-methyl-
- 1-Naphthalenemethanamine, .alpha.-methyl-, (S)-
- alpha-Naphthyl Ethyl Amine
Click to show/hide the synonyms
|
| Properties |
| Property |
Value |
| MW |
171.24 g/mol |
| HBD |
1 |
| HBA |
1 |
| Rotatable Bond Count |
1 |
| Exact Mass |
171.104799419 g/mol |
| Monoisotopic Mass |
171.104799419 g/mol |
| Heavy Atom Count |
13 |
| Isotope Atom Count |
0 |
| Atom Stereo Count |
1 |
| Covalent Unit Count |
1 |
| Complexity |
167 |
| xlogp |
2.8 |
| Topological Polar Surface Area |
26 |
|