|
Structure
|
|
| Relationships |
Total Number of functionally related protein(s) :
869
Total Number of Articles : 1039
|
| PubChem |
864
|
| Molecular Formula |
C8H14O2S2 |
| SMILES |
C1CSSC1CCCCC(=O)O |
| InChI |
InChI=1S/C8H14O2S2/c9-8(10)4-2-1-3-7-5-6-11-12-7/h7H,1-6H2,(H,9,10) |
| synonyms |
- thioctic acid
- dl-Thioctic acid
- 1077-28-7
- alpha-Lipoic acid
- 5-(1,2-Dithiolan-3-yl)pentanoic acid
- DL-alpha-Lipoic acid
- 1,2-dithiolane-3-pentanoic acid
- alpha Lipoic Acid
- Biletan
- 6,8-Thioctic acid
- 62-46-4
- Thioctacid
- DL-6,8-Thioctic acid
- dl-Lipoic acid
- 6-Thioctic acid
- Lipothion
- Liposan
- Thioctsan
- Tioctacid
- Rac-lipoate
- 1,2-Dithiolane-3-valeric acid
- 6,8-Dithiooctanoic acid
- alpha-Liponsaeure
- DL-6-Thioctic acid
- Thioctic acid dl-form
- alpha-liponic acid
- Thioktsaeure
- Tioctidasi
- (RS)-Lipoic acid
- 5-(dithiolan-3-yl)pentanoic acid
Click to show/hide the synonyms
|
| Properties |
| Property |
Value |
| MW |
206.3 g/mol |
| HBD |
1 |
| HBA |
4 |
| Rotatable Bond Count |
5 |
| Exact Mass |
206.04352203 g/mol |
| Monoisotopic Mass |
206.04352203 g/mol |
| Heavy Atom Count |
12 |
| Isotope Atom Count |
0 |
| Atom Stereo Count |
1 |
| Covalent Unit Count |
1 |
| Complexity |
150 |
| xlogp |
1.7 |
| Topological Polar Surface Area |
87.9 |
|