|
Structure
|
|
| Relationships |
Total Number of functionally related protein(s) :
20
Total Number of Articles : 18
|
| PubChem |
44207238
|
| Molecular Formula |
C14H11Cl2NO4 |
| SMILES |
C1=CC(=C(C=C1NCC2=C(C(=CC(=C2)Cl)Cl)O)O)C(=O)O |
| InChI |
InChI=1S/C14H11Cl2NO4/c15-8-3-7(13(19)11(16)4-8)6-17-9-1-2-10(14(20)21)12(18)5-9/h1-5,17-19H,6H2,(H,20,21) |
| synonyms |
- ZL006
- 1181226-02-7
- 4-((3,5-dichloro-2-hydroxybenzyl)amino)-2-hydroxybenzoic acid
- ZL-006
- CHEMBL3134413
- 4-[(3,5-dichloro-2-hydroxyphenyl)methylamino]-2-hydroxybenzoic acid
- 245DFR6JM5
- SCHEMBL15367533
- BCP32613
- GXB22602
- BDBM50496620
- AKOS032945012
- CS-5881
- ZL-006; ZL 006
- ZL-006?
- DA-68856
- MS-24906
- ZL006, >=98% (HPLC)
- HY-100456
- F85438
- 4-(3,5-dichloro-2-hydroxy-benzylamino)-2-hydroxybenzoic acid
- 4-(3,5-Dichloro-2-hydroxybenzylamino)-2-hydroxybenzoic acid
- 4-[[(3,5-dichloro-2-hydroxyphenyl)methyl]amino]-2-hydroxy-benzoic acid
- Benzoic acid, 4-[[(3,5-dichloro-2-hydroxyphenyl)methyl]amino]-2-hydroxy-
Click to show/hide the synonyms
|
| Properties |
| Property |
Value |
| MW |
328.1 g/mol |
| HBD |
4 |
| HBA |
5 |
| Rotatable Bond Count |
4 |
| Exact Mass |
327.0065132 g/mol |
| Monoisotopic Mass |
327.0065132 g/mol |
| Heavy Atom Count |
21 |
| Isotope Atom Count |
0 |
| Atom Stereo Count |
0 |
| Covalent Unit Count |
1 |
| Complexity |
371 |
| xlogp |
4 |
| Topological Polar Surface Area |
89.8 |
|