|
Structure
|
|
| Relationships |
Total Number of functionally related protein(s) :
32
Total Number of Articles : 29
|
| PubChem |
729483
|
| Molecular Formula |
C15H11NO3S2 |
| SMILES |
C1=CC=C2C(=C1)C=CC(=C2C=NS(=O)(=O)C3=CC=CS3)O |
| InChI |
InChI=1S/C15H11NO3S2/c17-14-8-7-11-4-1-2-5-12(11)13(14)10-16-21(18,19)15-6-3-9-20-15/h1-10,17H |
| synonyms |
- STF-083010
- 307543-71-1
- stf 083010
- N-[(2-Hydroxy-1-naphthalenyl)methylene]-2-thiophenesulfonamide
- N-[(2-hydroxynaphthalen-1-yl)methylidene]thiophene-2-sulfonamide
- N-[(Z)-(2-oxonaphthalen-1-ylidene)methyl]thiophene-2-sulfonamide
- (E)-N-((2-hydroxynaphthalen-1-yl)methylene)thiophene-2-sulfonamide
- N-{[(1Z)-2-oxonaphthalen-1-ylidene]methyl}thiophene-2-sulfonamide
- STF083010
- IFLab1_004901
- CHEMBL1538026
- DTXSID701177936
- GLXC-02852
- HMS2427H09
- BCP16458
- STF-083010?
- NCGC00263141-01
- EU-0079319
- C74585
Click to show/hide the synonyms
|
| Properties |
| Property |
Value |
| MW |
317.4 g/mol |
| HBD |
1 |
| HBA |
5 |
| Rotatable Bond Count |
3 |
| Exact Mass |
317.01803556 g/mol |
| Monoisotopic Mass |
317.01803556 g/mol |
| Heavy Atom Count |
21 |
| Isotope Atom Count |
0 |
| Atom Stereo Count |
0 |
| Covalent Unit Count |
1 |
| Complexity |
486 |
| xlogp |
3.7 |
| Topological Polar Surface Area |
103 |
|