PMID-sentid	Pub_year	Sent_text		comp_official_name	comp_offsetprotein_name	organism	prot_offset
16172639-6	2005	From this study it could be inferred that the out-of-plane distortion mainly involves weak, electrostatic interactions between a chlorine atom and an ortho-aromatic H atom of the N(1)-linked phenyl group, as well as between the other chlorine atom and an ortho-aromatic H atom of the PPh(3) group.	Chlorine	129-137	caveolin 1	Homo sapiens	284-290	
18627523-5	2008	Instead it is proposed that an association complex between excited state [IrCl(CO)(PPh3)2] and CHCl3 leads to dissociation of a chlorine atom from CHCl3, yielding HCl after abstraction of a hydrogen from another CHCl3.	Chlorine	128-136	caveolin 1	Homo sapiens	83-87	
29624070-2	2018	CF3SCl, which is generated by the reduction of PPh3, undergoes electrophilic addition and then chlorination to give the bifunctionalized products without using an additional chlorine source.	Chlorine	174-182	caveolin 1	Homo sapiens	47-51	
19082057-5	2008	In complex each micro-PHCH(2)Fc group bridging two palladium atoms has a terminal PPh(3) ligand in trans position with respect to the first Pd (the cis position being occupied by a chlorine) and a chlorine ligand trans to the other Pd (the cis position being occupied by a terminal PPh(3) ligand) thus rendering chemically equivalent the three PPh(3) (and the three phosphides).	Chlorine	181-189	caveolin 1	Homo sapiens	82-88	
19082057-5	2008	In complex each micro-PHCH(2)Fc group bridging two palladium atoms has a terminal PPh(3) ligand in trans position with respect to the first Pd (the cis position being occupied by a chlorine) and a chlorine ligand trans to the other Pd (the cis position being occupied by a terminal PPh(3) ligand) thus rendering chemically equivalent the three PPh(3) (and the three phosphides).	Chlorine	197-205	caveolin 1	Homo sapiens	82-88	
16172639-6	2005	From this study it could be inferred that the out-of-plane distortion mainly involves weak, electrostatic interactions between a chlorine atom and an ortho-aromatic H atom of the N(1)-linked phenyl group, as well as between the other chlorine atom and an ortho-aromatic H atom of the PPh(3) group.	Chlorine	234-242	caveolin 1	Homo sapiens	284-290	
15740113-1	2005	Treatment of the allenylcarbene complex OsCl2(=CPh-CH=C=CHPh)(PPh3)2 with (PPh3)AuCCR in the presence of HNEt3Cl in CH2Cl2 produces osmabenzynes Os(CC(R)=C(CH2Ph)CH=CPh)Cl2(PPh3)2.	Chlorine	42-45	caveolin 1	Homo sapiens	62-66	
15740113-1	2005	Treatment of the allenylcarbene complex OsCl2(=CPh-CH=C=CHPh)(PPh3)2 with (PPh3)AuCCR in the presence of HNEt3Cl in CH2Cl2 produces osmabenzynes Os(CC(R)=C(CH2Ph)CH=CPh)Cl2(PPh3)2.	Chlorine	42-45	caveolin 1	Homo sapiens	75-79	
15740113-1	2005	Treatment of the allenylcarbene complex OsCl2(=CPh-CH=C=CHPh)(PPh3)2 with (PPh3)AuCCR in the presence of HNEt3Cl in CH2Cl2 produces osmabenzynes Os(CC(R)=C(CH2Ph)CH=CPh)Cl2(PPh3)2.	Chlorine	42-45	caveolin 1	Homo sapiens	75-79