PMID-sentid	Pub_year	Sent_text		comp_official_name	comp_offsetprotein_name	organism	prot_offset
11666733-8	1996	Crystal data for PtP(2)O(3)C(28)H(26).CH(2)Cl(2): P2(1)/c, Z = 4, T approximately 298 K, a = 11.744(2) A, b = 15.526(3) A, c = 15.866(3) A, beta = 101.58(1) degrees.	Methylene Chloride	38-48	cyclin dependent kinase inhibitor 1A	Homo sapiens	50-57	
15962962-5	2005	Complex 5 x (1/2)CH2Cl2 crystallizes in the monoclinic space group P2(1)/c and contains two [Mn3(mu3-O)]7+ units linked at two of their apexes by two Pe(t)CO2(-) ligands and one mu4-CH2O2(2-) bridge.	Methylene Chloride	17-23	cyclin dependent kinase inhibitor 1A	Homo sapiens	67-72	
11670447-4	1998	The compound crystallizes as a solvate with two molecules of CH(2)Cl(2) per formula unit in the monoclinic space group P2(1)/n with a = 1570.5(2) pm, b = 1060.2(1) pm, c = 1604.0(2) pm, beta = 114.93(1) degrees, and Z = 2.	Methylene Chloride	61-71	cyclin dependent kinase inhibitor 1A	Homo sapiens	119-124	
7827263-4	1994	The compound crystallizes in the monoclinic space group P2(1) from methanol-dichloromethane solution.	Methylene Chloride	76-91	cyclin dependent kinase inhibitor 1A	Homo sapiens	56-61