|
Structure
|
|
| Relationships |
Total Number of functionally related protein(s) :
14
Total Number of Articles : 26
|
| PubChem |
448393
|
| Molecular Formula |
C8H20N4 |
| SMILES |
C(CCCN)CCCN=C(N)N |
| InChI |
InChI=1S/C8H20N4/c9-6-4-2-1-3-5-7-12-8(10)11/h1-7,9H2,(H4,10,11,12) |
| synonyms |
- 2-(7-aminoheptyl)guanidine
- 150333-69-0
- N-guanyl-1,7-diaminoheptane
- 1,7-Diaminoheptane, N-amidino-
- 1-(7-aminoheptyl)guanidine
- N-(7-Aminoheptyl)guanidine
- CHEMBL229457
- GC-7
- GC7
- MFCD20667694
- N1-Guanyl-1,7-diaminoheptane (GC7)
- SCHEMBL433609
- N-(7-Amino-heptyl)-guanidine
- n(1)-guanyl-1,7-diaminoheptane
- CHEBI:133366
- GLXC-21426
- BDBM50216786
- Deoxyhypusine Synthase Inhibitor, GC-7
- HY-108314
- CS-0028310
- N1-Guanyl-1,7-diaminoheptane; 2-(7-aminoheptyl)guanidine
Click to show/hide the synonyms
|
| Properties |
| Property |
Value |
| MW |
172.27 g/mol |
| HBD |
3 |
| HBA |
2 |
| Rotatable Bond Count |
7 |
| Exact Mass |
172.16879665 g/mol |
| Monoisotopic Mass |
172.16879665 g/mol |
| Heavy Atom Count |
12 |
| Isotope Atom Count |
0 |
| Atom Stereo Count |
0 |
| Covalent Unit Count |
1 |
| Complexity |
118 |
| xlogp |
-0.3 |
| Topological Polar Surface Area |
90.4 |
|