|
Structure
|
|
| Relationships |
Total Number of functionally related protein(s) :
1
Total Number of Articles : 1
|
| PubChem |
160817
|
| Molecular Formula |
C15H10O3 |
| SMILES |
CC1=C(C2=C(C=C1)C(=O)C3=CC=CC=C3C2=O)O |
| InChI |
InChI=1S/C15H10O3/c1-8-6-7-11-12(13(8)16)15(18)10-5-3-2-4-9(10)14(11)17/h2-7,16H,1H3 |
| synonyms |
- 1-Hydroxy-2-methylanthraquinone
- 6268-09-3
- 1-hydroxy-2-methylanthracene-9,10-dione
- 1-hydroxy-2-methyl-9,10-anthraquinone
- Anthraquinone, 1-hydroxy-2-methyl-
- CHEMBL42302
- CHEBI:69534
- 1-Hydroxy-2-methyl-anthraquinone
- CCRIS 6433
- NSC37131
- 9, 1-hydroxy-2-methyl-
- SCHEMBL1426900
- 1-hydroxy-2-methyl-9,10-dihydroanthracene-9,10-dione
- DTXSID80211733
- CZODYZFOLUNSFR-UHFFFAOYSA-N
- HY-N1625
- BDBM50005901
- NSC 37131
- NSC-37131
- AKOS022660290
- FS-7811
- 1-hydroxy-2-methyl-anthracene-9,10-dione
- 1-Hydroxy-2-methylanthra-9,10-quinone #
- 9,10-Anthracenedione, 1-hydroxy-2-methyl-
- CS-0017286
- E88872
- Q27137873
Click to show/hide the synonyms
|
| Properties |
| Property |
Value |
| MW |
238.24 g/mol |
| HBD |
1 |
| HBA |
3 |
| Rotatable Bond Count |
0 |
| Exact Mass |
238.062994177 g/mol |
| Monoisotopic Mass |
238.062994177 g/mol |
| Heavy Atom Count |
18 |
| Isotope Atom Count |
0 |
| Atom Stereo Count |
0 |
| Covalent Unit Count |
1 |
| Complexity |
376 |
| xlogp |
3.9 |
| Topological Polar Surface Area |
54.4 |
|